CAS 4046-70-2 appears in our catalog under these names: 5-Methyl-1,2,4-triazino[5,6-b]indole-3-thiol, 95%, 5-Methyl-4,5-dihydro-1,2,4-triazino(5,6-b)indole-3-thione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 100mg, 10mg.
5-methyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione (CAS 4046-70-2) is a chemical compound with the molecular formula C10H8N4S and a molecular weight of 216.26 g/mol. IUPAC name: 5-methyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione. InChIKey: RZYGCPYYIBGBCX-UHFFFAOYSA-N.
| Molecular formula | C10H8N4S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 5-methyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
| InChIKey | RZYGCPYYIBGBCX-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C3=NNC(=S)N=C31 |
Computed by PubChem (NCBI)