CAS 1341887-20-4 appears in our catalog under these names: 2-(1H-Imidazol-1-yl)-1,3-benzothiazol-6-amine, 95%, 2-(1H-Imidazol-1-yl)-1,3-benzothiazol-6-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-imidazol-1-yl-1,3-benzothiazol-6-amine (CAS 1341887-20-4) is a chemical compound with the molecular formula C10H8N4S and a molecular weight of 216.26 g/mol. IUPAC name: 2-imidazol-1-yl-1,3-benzothiazol-6-amine. InChIKey: LVELDZDMOXTOHR-UHFFFAOYSA-N.
| Molecular formula | C10H8N4S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 2-imidazol-1-yl-1,3-benzothiazol-6-amine |
| InChIKey | LVELDZDMOXTOHR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)SC(=N2)N3C=CN=C3 |
Computed by PubChem (NCBI)