CAS 25893-06-5 is the registry number for 2-(Thiazol-4-yl)-1H-benzo[d]imidazol-6-amine, 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 250mg.
2-(1,3-thiazol-4-yl)-3H-benzimidazol-5-amine (CAS 25893-06-5) is a chemical compound with the molecular formula C10H8N4S and a molecular weight of 216.26 g/mol. IUPAC name: 2-(1,3-thiazol-4-yl)-3H-benzimidazol-5-amine. InChIKey: CUDHOGCHOXYXRZ-UHFFFAOYSA-N.
| Molecular formula | C10H8N4S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 2-(1,3-thiazol-4-yl)-3H-benzimidazol-5-amine |
| InChIKey | CUDHOGCHOXYXRZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)NC(=N2)C3=CSC=N3 |
Computed by PubChem (NCBI)