CAS 83515-26-8 appears in our catalog under these names: 6-Methyl-5h-[1,2,4]triazino[5,6-b]indole-3-thiol, 95%, 6-Methyl-5H-(1,2,4)triazino(5,6-b)indole-3-thiol, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 25g.
6-methyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione (CAS 83515-26-8) is a chemical compound with the molecular formula C10H8N4S and a molecular weight of 216.26 g/mol. IUPAC name: 6-methyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione. InChIKey: LUORUVIRDVFHRU-UHFFFAOYSA-N.
| Molecular formula | C10H8N4S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 6-methyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione |
| InChIKey | LUORUVIRDVFHRU-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C3=NNC(=S)N=C3N2 |
Computed by PubChem (NCBI)