Products 101601-00-7

CAS 101601-00-7 is the registry number for 5-Benzyloxyindole 3-Glyoxylic Acid. Offered by: TRC. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid (CAS 101601-00-7) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid. InChIKey: OLSKVXZVSAPWRO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13NO4
Molecular weight295.29 g/mol
IUPAC name2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid
InChIKeyOLSKVXZVSAPWRO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C3C(=O)C(=O)O

Computed by PubChem (NCBI)