Products 1016696-41-5
CAS 1016696-41-5 is the registry number for 2-(Sulfanylmethyl)-4H-pyrido(1,2-a)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(sulfanylmethyl)pyrido[1,2-a]pyrimidin-4-one (CAS 1016696-41-5) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 2-(sulfanylmethyl)pyrido[1,2-a]pyrimidin-4-one. InChIKey: KUFCXHYHIPEVSK-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 2-(sulfanylmethyl)pyrido[1,2-a]pyrimidin-4-one |
| InChIKey | KUFCXHYHIPEVSK-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CC(=O)N2C=C1)CS |
Computed by PubChem (NCBI)