Products 1017083-55-4
CAS 1017083-55-4 is the registry number for 3'-Bromo-4'-fluoro-β-methyl-β-nitrostyrene. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg.
2-bromo-1-fluoro-4-[(E)-2-nitroprop-1-enyl]benzene (CAS 1017083-55-4) is a chemical compound with the molecular formula C9H7BrFNO2 and a molecular weight of 260.06 g/mol. IUPAC name: 2-bromo-1-fluoro-4-[(E)-2-nitroprop-1-enyl]benzene. InChIKey: ODKDHDCPXXAXPP-GQCTYLIASA-N.
| Molecular formula | C9H7BrFNO2 |
|---|---|
| Molecular weight | 260.06 g/mol |
| IUPAC name | 2-bromo-1-fluoro-4-[(E)-2-nitroprop-1-enyl]benzene |
| InChIKey | ODKDHDCPXXAXPP-GQCTYLIASA-N |
| SMILES | C/C(=C\C1=CC(=C(C=C1)F)Br)/[N+](=O)[O-] |
Computed by PubChem (NCBI)