CAS 1267046-92-3 is the registry number for 8-Bromo-6-fluoro-2-methyl-2,4-dihydro-1,4-benzoxazin-3-one, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
8-bromo-6-fluoro-2-methyl-4H-1,4-benzoxazin-3-one (CAS 1267046-92-3) is a chemical compound with the molecular formula C9H7BrFNO2 and a molecular weight of 260.06 g/mol. IUPAC name: 8-bromo-6-fluoro-2-methyl-4H-1,4-benzoxazin-3-one. InChIKey: KGWJZEBWSYTSQN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO2 |
|---|---|
| Molecular weight | 260.06 g/mol |
| IUPAC name | 8-bromo-6-fluoro-2-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | KGWJZEBWSYTSQN-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C(=CC(=C2)F)Br |
Computed by PubChem (NCBI)