CAS 1566149-13-0 appears in our catalog under these names: 7–Bromo–9–fluoro–3,4–dihydro–1,4–benzoxazepin–5(2H)–one, 7-Bromo-9-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one. Offered by: GLPBio, Biosynth. Available pack sizes: 250mg, 50mg, 25mg.
7-bromo-9-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one (CAS 1566149-13-0) is a chemical compound with the molecular formula C9H7BrFNO2 and a molecular weight of 260.06 g/mol. IUPAC name: 7-bromo-9-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one. InChIKey: LNHXAMBTQSEKMY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO2 |
|---|---|
| Molecular weight | 260.06 g/mol |
| IUPAC name | 7-bromo-9-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| InChIKey | LNHXAMBTQSEKMY-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2F)Br)C(=O)N1 |
Computed by PubChem (NCBI)