CAS 1564451-53-1 appears in our catalog under these names: 7-Bromo-8-fluoro-3,4-dihydrobenzo(f)(1,4)oxazepin-5(2H)-one, 97%, 7–Bromo–8–fluoro–3,4–dihydro–1,4–benzoxazepin–5(2H)–one, 7-Bromo-8-fluoro-2,3,4,5-tetrahydro-1,4-benzoxazepin-5-one. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 10g, 250mg, 50mg, 0,5g.
7-bromo-8-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one (CAS 1564451-53-1) is a chemical compound with the molecular formula C9H7BrFNO2 and a molecular weight of 260.06 g/mol. IUPAC name: 7-bromo-8-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one. InChIKey: FDLCCMFQVJTURC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO2 |
|---|---|
| Molecular weight | 260.06 g/mol |
| IUPAC name | 7-bromo-8-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| InChIKey | FDLCCMFQVJTURC-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2C(=O)N1)Br)F |
Computed by PubChem (NCBI)