Products 2952910-43-7
CAS 2952910-43-7 is the registry number for 6-Bromo-4-fluoro-5-methoxy-2-methylbenzo[d]oxazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
6-bromo-4-fluoro-5-methoxy-2-methyl-1,3-benzoxazole (CAS 2952910-43-7) is a chemical compound with the molecular formula C9H7BrFNO2 and a molecular weight of 260.06 g/mol. IUPAC name: 6-bromo-4-fluoro-5-methoxy-2-methyl-1,3-benzoxazole. InChIKey: XOBBDGSMCJOSMX-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO2 |
|---|---|
| Molecular weight | 260.06 g/mol |
| IUPAC name | 6-bromo-4-fluoro-5-methoxy-2-methyl-1,3-benzoxazole |
| InChIKey | XOBBDGSMCJOSMX-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=C(C=C2O1)Br)OC)F |
Computed by PubChem (NCBI)