CAS 1962125-90-1 appears in our catalog under these names: 8-Bromo-6-fluoro-3,4-dihydrobenzo[f][1,4]oxazepin-5(2h)-one, 95%, 8-Bromo-6-fluoro-3,4-dihydrobenzo(f)(1,4)oxazepin-5(2H)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 100mg, 1g, 2,5g.
8-bromo-6-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one (CAS 1962125-90-1) is a chemical compound with the molecular formula C9H7BrFNO2 and a molecular weight of 260.06 g/mol. IUPAC name: 8-bromo-6-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one. InChIKey: FQRXWSROGSKCGD-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO2 |
|---|---|
| Molecular weight | 260.06 g/mol |
| IUPAC name | 8-bromo-6-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| InChIKey | FQRXWSROGSKCGD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C(=CC(=C2)Br)F)C(=O)N1 |
Computed by PubChem (NCBI)