CAS 1267704-16-4 is the registry number for 7–Bromo–9–fluoro–2,3,4,5–tetrahydro–1,5–benzoxazepin–4–one. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
7-bromo-9-fluoro-3,5-dihydro-2H-1,5-benzoxazepin-4-one (CAS 1267704-16-4) is a chemical compound with the molecular formula C9H7BrFNO2 and a molecular weight of 260.06 g/mol. IUPAC name: 7-bromo-9-fluoro-3,5-dihydro-2H-1,5-benzoxazepin-4-one. InChIKey: XUTBPJAZYHHGAQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO2 |
|---|---|
| Molecular weight | 260.06 g/mol |
| IUPAC name | 7-bromo-9-fluoro-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| InChIKey | XUTBPJAZYHHGAQ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2F)Br)NC1=O |
Computed by PubChem (NCBI)