Products 1697887-57-2
CAS 1697887-57-2 is the registry number for 2-Bromo-3-fluoro-4-(2-hydroxyethoxy)benzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-3-fluoro-4-(2-hydroxyethoxy)benzonitrile (CAS 1697887-57-2) is a chemical compound with the molecular formula C9H7BrFNO2 and a molecular weight of 260.06 g/mol. IUPAC name: 2-bromo-3-fluoro-4-(2-hydroxyethoxy)benzonitrile. InChIKey: OSPCHPQAAJTOQM-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO2 |
|---|---|
| Molecular weight | 260.06 g/mol |
| IUPAC name | 2-bromo-3-fluoro-4-(2-hydroxyethoxy)benzonitrile |
| InChIKey | OSPCHPQAAJTOQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)Br)F)OCCO |
Computed by PubChem (NCBI)