CAS 2658494-15-4 is the registry number for 7-Bromo-6-fluoro-4-methyl-1,4-dihydro-2H-benzo[d][1,3]oxazin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-6-fluoro-4-methyl-1,4-dihydro-3,1-benzoxazin-2-one (CAS 2658494-15-4) is a chemical compound with the molecular formula C9H7BrFNO2 and a molecular weight of 260.06 g/mol. IUPAC name: 7-bromo-6-fluoro-4-methyl-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: MVNXXNVXFVZFQU-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO2 |
|---|---|
| Molecular weight | 260.06 g/mol |
| IUPAC name | 7-bromo-6-fluoro-4-methyl-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | MVNXXNVXFVZFQU-UHFFFAOYSA-N |
| SMILES | CC1C2=CC(=C(C=C2NC(=O)O1)Br)F |
Computed by PubChem (NCBI)