Products 24796-59-6
CAS 24796-59-6 appears in our catalog under these names: 6-Chloro-4-oxo-1,4-dihydroquinoline-2-carboxylic acid, 95%, 6-Chloro-4-oxo-1,4-dihydroquinoline-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
6-chloro-4-oxo-1H-quinoline-2-carboxylic acid (CAS 24796-59-6) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 6-chloro-4-oxo-1H-quinoline-2-carboxylic acid. InChIKey: FBHYBXRWVNVMRY-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 6-chloro-4-oxo-1H-quinoline-2-carboxylic acid |
| InChIKey | FBHYBXRWVNVMRY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)