CAS 77514-31-9 appears in our catalog under these names: 2,6-Dibromoquinoline, 95-<97%, 2,6-Dibromoquinoline, 95+%. Offered by: Hoffman Fine Chemicals, AmBeed. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 1g.
2,6-dibromoquinoline (CAS 77514-31-9) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 2,6-dibromoquinoline. InChIKey: OISLXVPFMYSILE-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 2,6-dibromoquinoline |
| InChIKey | OISLXVPFMYSILE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)Br)C=C1Br |
Computed by PubChem (NCBI)