Products 140134-65-2
CAS 140134-65-2 is the registry number for (E)-3-(4-(Methylthio)phenyl)acrylic acid, 95+%. Offered by: Ambeed. Available pack sizes: 1g, 5g.
(E)-3-(4-methylsulfanylphenyl)prop-2-enoic acid (CAS 140134-65-2) is a chemical compound with the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. IUPAC name: (E)-3-(4-methylsulfanylphenyl)prop-2-enoic acid. InChIKey: AHBHKZCSIUIANZ-QPJJXVBHSA-N.
| Molecular formula | C10H10O2S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | (E)-3-(4-methylsulfanylphenyl)prop-2-enoic acid |
| InChIKey | AHBHKZCSIUIANZ-QPJJXVBHSA-N |
| SMILES | CSC1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-[4-(methylsulfanyl)phenyl]prop-2-enoic acid, (2E)-3-(4-(methylsulfanyl)phenyl)prop-2-enoic acid, 3-(4-(Methylthio)phenyl)acrylic acid, 3-[4-(methylsulfanyl)phenyl]acrylic acid, (E)-3-(4-(methylthio)phenyl)acrylic acid, (E)-3-(4-methylsulfanylphenyl)prop-2-enoic acid, 2-Propenoic acid, 3-[4-(methylthio)phenyl]-, p-[Methylthio]cinnamic acid, (2E)-3-(4-methylthiophenyl)prop-2-enoic acid, 4-(Methylthio)cinnamic acid