Products 1023509-67-2
CAS 1023509-67-2 is the registry number for 2-((2,5-dihydroxyphenyl)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(2,5-dihydroxyphenyl)methylidene]indene-1,3-dione (CAS 1023509-67-2) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: 2-[(2,5-dihydroxyphenyl)methylidene]indene-1,3-dione. InChIKey: XQQGGKTZSNMUKW-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 2-[(2,5-dihydroxyphenyl)methylidene]indene-1,3-dione |
| InChIKey | XQQGGKTZSNMUKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CC3=C(C=CC(=C3)O)O)C2=O |
Computed by PubChem (NCBI)