CAS 102771-62-0 appears in our catalog under these names: Imazethapyr Impurity 14, 5-Hydroxy Imazapyr. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 5mg, 10mg, 25mg, 50mg.
5-hydroxy-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid (CAS 102771-62-0) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: 5-hydroxy-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid. InChIKey: NPZVMJUVFWHFPW-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 5-hydroxy-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid |
| InChIKey | NPZVMJUVFWHFPW-UHFFFAOYSA-N |
| SMILES | CC(C)C1(C(=O)NC(=N1)C2=C(C=C(C=N2)O)C(=O)O)C |
Computed by PubChem (NCBI)