CAS 1305325-08-9 is the registry number for 1-tert-Butyl 5-methyl 1h-pyrazolo[3,4-b]pyridine-1,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-O-tert-butyl 5-O-methyl pyrazolo[3,4-b]pyridine-1,5-dicarboxylate (CAS 1305325-08-9) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl pyrazolo[3,4-b]pyridine-1,5-dicarboxylate. InChIKey: MTBRBUYOTCUDQQ-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 1-O-tert-butyl 5-O-methyl pyrazolo[3,4-b]pyridine-1,5-dicarboxylate |
| InChIKey | MTBRBUYOTCUDQQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=NC=C(C=C2C=N1)C(=O)OC |
Computed by PubChem (NCBI)