Products 874760-69-7
CAS 874760-69-7 appears in our catalog under these names: Lenalidomide Impurity 51, Lenalidomide Impurity 50, (S)-5-Amino-2-(4-amino-1-oxoisoindolin-2-yl)-5-oxopentanoic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
(2S)-5-amino-2-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid (CAS 874760-69-7) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: (2S)-5-amino-2-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid. InChIKey: KSCACLRGQJXDAB-JTQLQIEISA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | (2S)-5-amino-2-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid |
| InChIKey | KSCACLRGQJXDAB-JTQLQIEISA-N |
| SMILES | C1C2=C(C=CC=C2N)C(=O)N1[C@@H](CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)