CAS 1207529-87-0 appears in our catalog under these names: N-Methyl-1-(5-phenyl-1h-pyrazol-3-yl)methanamine oxalate, 95%, N-Methyl-1-(5-phenyl-1H-pyrazol-3-yl)methanamine oxalate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
N-methyl-1-(3-phenyl-1H-pyrazol-5-yl)methanamine;oxalic acid (CAS 1207529-87-0) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: N-methyl-1-(3-phenyl-1H-pyrazol-5-yl)methanamine;oxalic acid. InChIKey: PDMXQCURSULJKQ-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | N-methyl-1-(3-phenyl-1H-pyrazol-5-yl)methanamine;oxalic acid |
| InChIKey | PDMXQCURSULJKQ-UHFFFAOYSA-N |
| SMILES | CNCC1=CC(=NN1)C2=CC=CC=C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)