Products 2730879-77-1
CAS 2730879-77-1 is the registry number for Methyl 2-(7-formyl-4-isopropyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2(1H)-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(7-formyl-1-oxo-4-propan-2-ylpyrrolo[1,2-d][1,2,4]triazin-2-yl)acetate (CAS 2730879-77-1) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: methyl 2-(7-formyl-1-oxo-4-propan-2-ylpyrrolo[1,2-d][1,2,4]triazin-2-yl)acetate. InChIKey: PUUURHRNOYGGJP-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | methyl 2-(7-formyl-1-oxo-4-propan-2-ylpyrrolo[1,2-d][1,2,4]triazin-2-yl)acetate |
| InChIKey | PUUURHRNOYGGJP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C(=O)C2=CC(=CN21)C=O)CC(=O)OC |
Computed by PubChem (NCBI)