Products 2197420-75-8
CAS 2197420-75-8 appears in our catalog under these names: Lenalidomide Impurity 12, Lenalidomide Impurity C, Lenalidomide Impurity 2, 2-(4-Amino-1-oxoisoindolin-2-yl)-4-carbamoyl Butyric Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
5-amino-2-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid (CAS 2197420-75-8) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: 5-amino-2-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid. InChIKey: KSCACLRGQJXDAB-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 5-amino-2-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid |
| InChIKey | KSCACLRGQJXDAB-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2N)C(=O)N1C(CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)