CAS 63896-86-6 is the registry number for N,N'-(Pyridine-2,6-diyl)bis(3-oxobutanamide), 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-oxo-N-[6-(3-oxobutanoylamino)-2-pyridinyl]butanamide (CAS 63896-86-6) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: 3-oxo-N-[6-(3-oxobutanoylamino)-2-pyridinyl]butanamide. InChIKey: DHZQCPZPEGHVNI-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 3-oxo-N-[6-(3-oxobutanoylamino)-2-pyridinyl]butanamide |
| InChIKey | DHZQCPZPEGHVNI-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC1=NC(=CC=C1)NC(=O)CC(=O)C |
Computed by PubChem (NCBI)