CAS 874760-72-2 appears in our catalog under these names: Lenalidomide Impurity 1, Lenalidomide Impurity E, (S)-5-Amino-4-(4-amino-1-oxoisoindolin-2-yl)-5-oxopentanoic Acid, >95% (HPLC), (S)-5-Amino-4-(4-amino-1-oxoisoindolin-2-yl)-5-oxopentanoic Acid, 95%, 95%, (S)-5-Amino-4-(4-amino-1-oxoisoindolin-2-yl)-5-oxopentanoic acid, 95%. Offered by: Chemat Brand, TRC, Chemat, Ambeed. Available pack sizes: on request, 250mg, 100mg, 1g.
(4S)-5-amino-4-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid (CAS 874760-72-2) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: (4S)-5-amino-4-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid. InChIKey: USYWQLIFELNXTA-JTQLQIEISA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | (4S)-5-amino-4-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid |
| InChIKey | USYWQLIFELNXTA-JTQLQIEISA-N |
| SMILES | C1C2=C(C=CC=C2N)C(=O)N1[C@@H](CCC(=O)O)C(=O)N |
Computed by PubChem (NCBI)