CAS 2197414-57-4 appears in our catalog under these names: 4-(4-Amino-1-oxoisoindolin-2-yl)-4-carbamoyl Butyric Acid, >95% (HPLC), 5-Amino-4-(4-amino-1-oxoisoindolin-2-yl)-5-oxopentanoic acid, 97%, Lenalidomide Impurity 29, Lenalidomide Impurity 56, Lenalidomide Impurity 32. Offered by: TRC, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, on request.
5-amino-4-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid (CAS 2197414-57-4) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: 5-amino-4-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid. InChIKey: USYWQLIFELNXTA-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 5-amino-4-(7-amino-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid |
| InChIKey | USYWQLIFELNXTA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2N)C(=O)N1C(CCC(=O)O)C(=O)N |
Computed by PubChem (NCBI)