CAS 103-94-6 appears in our catalog under these names: 4-Nitrophenyloxamic acid, 96%, 2-((4-Nitrophenyl)amino)-2-oxoacetic acid, 4-Nitrophenyloxamic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.
2-(4-nitroanilino)-2-oxoacetic acid (CAS 103-94-6) is a chemical compound with the molecular formula C8H6N2O5 and a molecular weight of 210.14 g/mol. IUPAC name: 2-(4-nitroanilino)-2-oxoacetic acid. InChIKey: ZEJKSYPGUAUQKW-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O5 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | 2-(4-nitroanilino)-2-oxoacetic acid |
| InChIKey | ZEJKSYPGUAUQKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)