CAS 1195395-64-2 is the registry number for 6-Nitro-1,3-benzodioxole-5-carbaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine (CAS 1195395-64-2) is a chemical compound with the molecular formula C8H6N2O5 and a molecular weight of 210.14 g/mol. IUPAC name: (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine. InChIKey: QSUKJRNTONMMNX-YCRREMRBSA-N.
| Molecular formula | C8H6N2O5 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine |
| InChIKey | QSUKJRNTONMMNX-YCRREMRBSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)/C=N/O)[N+](=O)[O-] |
Computed by PubChem (NCBI)