Products 65911-46-8
CAS 65911-46-8 appears in our catalog under these names: 2-Carbamoyl-6-nitrobenzoic acid, 98%, 98%, 2-Carbamoyl-6-nitrobenzoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
2-carbamoyl-6-nitrobenzoic acid (CAS 65911-46-8) is a chemical compound with the molecular formula C8H6N2O5 and a molecular weight of 210.14 g/mol. IUPAC name: 2-carbamoyl-6-nitrobenzoic acid. InChIKey: QYLIVYPDIARSHA-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O5 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | 2-carbamoyl-6-nitrobenzoic acid |
| InChIKey | QYLIVYPDIARSHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)O)C(=O)N |
Computed by PubChem (NCBI)