CAS 2851527-30-3 is the registry number for 7-Hydroxy-5-nitro-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-hydroxy-5-nitro-4H-1,4-benzoxazin-3-one (CAS 2851527-30-3) is a chemical compound with the molecular formula C8H6N2O5 and a molecular weight of 210.14 g/mol. IUPAC name: 7-hydroxy-5-nitro-4H-1,4-benzoxazin-3-one. InChIKey: BOTLTSANKYUSEV-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O5 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | 7-hydroxy-5-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | BOTLTSANKYUSEV-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2O1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)