CAS 77326-45-5 appears in our catalog under these names: 2-Carbamoyl-3-nitrobenzoic acid, 95%, 2-Carbamoyl-3-nitrobenzoic acid, 95+%, 2-carbamoyl-3-nitrobenzoic acid, 2-Carbamoyl-3-nitrobenzoic acid, 97%,RG, 97%,RG. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-carbamoyl-3-nitrobenzoic acid (CAS 77326-45-5) is a chemical compound with the molecular formula C8H6N2O5 and a molecular weight of 210.14 g/mol. IUPAC name: 2-carbamoyl-3-nitrobenzoic acid. InChIKey: IGLWGHRTQOYFDV-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O5 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | 2-carbamoyl-3-nitrobenzoic acid |
| InChIKey | IGLWGHRTQOYFDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)N)C(=O)O |
Computed by PubChem (NCBI)