Products 2259312-02-0
CAS 2259312-02-0 is the registry number for Methyl 6-formyl-5-nitronicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-formyl-5-nitropyridine-3-carboxylate (CAS 2259312-02-0) is a chemical compound with the molecular formula C8H6N2O5 and a molecular weight of 210.14 g/mol. IUPAC name: methyl 6-formyl-5-nitropyridine-3-carboxylate. InChIKey: PZOLMOHZOWGPOE-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O5 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | methyl 6-formyl-5-nitropyridine-3-carboxylate |
| InChIKey | PZOLMOHZOWGPOE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)