CAS 87594-59-0 appears in our catalog under these names: 4-Carbamoyl-3-nitrobenzoic acid, 96%, 4-Aminocarbonyl-3-nitrobenzoic acid, 98% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g, 25g .
4-carbamoyl-3-nitrobenzoic acid (CAS 87594-59-0) is a chemical compound with the molecular formula C8H6N2O5 and a molecular weight of 210.14 g/mol. IUPAC name: 4-carbamoyl-3-nitrobenzoic acid. InChIKey: LKPGLAHLFCDSNK-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O5 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | 4-carbamoyl-3-nitrobenzoic acid |
| InChIKey | LKPGLAHLFCDSNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)