Products 90196-48-8
CAS 90196-48-8 appears in our catalog under these names: 3-Aminocarbonyl-5-nitrobenzoic acid, 95%, 3-carbamoyl-5-nitrobenzoic acid, 3-Carbamoyl-5-nitrobenzoic acid 97%, 3-Carbamoyl-5-nitrobenzoic acid, 97%, 97%, 3-Carbamoyl-5-nitrobenzoic acid, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 10g, 250mg.
3-carbamoyl-5-nitrobenzoic acid (CAS 90196-48-8) is a chemical compound with the molecular formula C8H6N2O5 and a molecular weight of 210.14 g/mol. IUPAC name: 3-carbamoyl-5-nitrobenzoic acid. InChIKey: BDXFKMQTIGVLEU-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O5 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | 3-carbamoyl-5-nitrobenzoic acid |
| InChIKey | BDXFKMQTIGVLEU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)