Products 14401-75-3
CAS 14401-75-3 appears in our catalog under these names: 3',5'-Dinitroacetophenone, 3',5'-DINITROACETOPHENONE, 97%, 3',5'-Dinitroacetophenone, min. 95 %, 5 g, 3',5'-Dinitroacetophenone, min. 95 %, 10 g, 3',5'-Dinitroacetophenone, min. 95 %, 25 g. Offered by: Biosynth, Sigma-Aldrich, Roth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 50g, 100g, 1G, 250mg.
1-(3,5-dinitrophenyl)ethanone (CAS 14401-75-3) is a chemical compound with the molecular formula C8H6N2O5 and a molecular weight of 210.14 g/mol. IUPAC name: 1-(3,5-dinitrophenyl)ethanone. InChIKey: WGJQPJOLPLYFJH-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O5 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | 1-(3,5-dinitrophenyl)ethanone |
| InChIKey | WGJQPJOLPLYFJH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)