CAS 52120-49-7 appears in our catalog under these names: 4-(2,4-Dinitrophenyl)butanoicacid, 4-(2,4-Dinitrophenyl)butanoic acid, ≥95%, ≥95%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
4-(2,4-dinitrophenyl)butanoic acid (CAS 52120-49-7) is a chemical compound with the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. IUPAC name: 4-(2,4-dinitrophenyl)butanoic acid. InChIKey: SWEYUZMSQYUAIL-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O6 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | 4-(2,4-dinitrophenyl)butanoic acid |
| InChIKey | SWEYUZMSQYUAIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])CCCC(=O)O |
Computed by PubChem (NCBI)