Products 1031063-36-1
CAS 1031063-36-1 appears in our catalog under these names: 3-(2-Naphthalenyl)-1-(3-pyridinyl)-2-propen-1-one/ 99.84% (existing batch purity), 3-(Naphthalen-2-yl)-1-(pyridin-3-yl)prop-2-en-1-one, 98%, DMU–2105(CYP1B1 inhibitor 7k), DMU2105, (E/Z)-DMU2105. Offered by: TargetMol, Chemat, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg.
(E)-3-naphthalen-2-yl-1-pyridin-3-ylprop-2-en-1-one (CAS 1031063-36-1) is a chemical compound with the molecular formula C18H13NO and a molecular weight of 259.3 g/mol. IUPAC name: (E)-3-naphthalen-2-yl-1-pyridin-3-ylprop-2-en-1-one. InChIKey: VWBDGXJRQZDLRV-CSKARUKUSA-N.
| Molecular formula | C18H13NO |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | (E)-3-naphthalen-2-yl-1-pyridin-3-ylprop-2-en-1-one |
| InChIKey | VWBDGXJRQZDLRV-CSKARUKUSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)/C=C/C(=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)