CAS 115552-06-2 is the registry number for 9-phenyl-9H-carbazol-3-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
9-phenylcarbazol-3-ol (CAS 115552-06-2) is a chemical compound with the molecular formula C18H13NO and a molecular weight of 259.3 g/mol. IUPAC name: 9-phenylcarbazol-3-ol. InChIKey: GYVSWICDTXVNLO-UHFFFAOYSA-N.
| Molecular formula | C18H13NO |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 9-phenylcarbazol-3-ol |
| InChIKey | GYVSWICDTXVNLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)O)C4=CC=CC=C42 |
Computed by PubChem (NCBI)