CAS 406488-21-9 is the registry number for N–Phenyldibenzo(b,d)furan–3–amine. Offered by: GLPBio. Available pack sizes: 5g.
N-phenyldibenzofuran-3-amine (CAS 406488-21-9) is a chemical compound with the molecular formula C18H13NO and a molecular weight of 259.3 g/mol. IUPAC name: N-phenyldibenzofuran-3-amine. InChIKey: DKHIHAFJMGYOEQ-UHFFFAOYSA-N.
| Molecular formula | C18H13NO |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | N-phenyldibenzofuran-3-amine |
| InChIKey | DKHIHAFJMGYOEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC3=C(C=C2)C4=CC=CC=C4O3 |
Computed by PubChem (NCBI)