CAS 59082-22-3 is the registry number for (E)-4-((1-Oxo-3,4-dihydronaphthalen-2(1H)-ylidene)methyl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzonitrile (CAS 59082-22-3) is a chemical compound with the molecular formula C18H13NO and a molecular weight of 259.3 g/mol. IUPAC name: 4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzonitrile. InChIKey: MENDGUCJODVXAP-LFIBNONCSA-N.
| Molecular formula | C18H13NO |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzonitrile |
| InChIKey | MENDGUCJODVXAP-LFIBNONCSA-N |
| SMILES | C1C/C(=C\C2=CC=C(C=C2)C#N)/C(=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)