CAS 861317-95-5 appears in our catalog under these names: N-Phenyldibenzo[b,d]furan-2-amine, 98%, 98%, N-Phenyldibenzo[b,d]furan-2-amine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
N-phenyldibenzofuran-2-amine (CAS 861317-95-5) is a chemical compound with the molecular formula C18H13NO and a molecular weight of 259.3 g/mol. IUPAC name: N-phenyldibenzofuran-2-amine. InChIKey: IABICDIEOYDAFF-UHFFFAOYSA-N.
| Molecular formula | C18H13NO |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | N-phenyldibenzofuran-2-amine |
| InChIKey | IABICDIEOYDAFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC3=C(C=C2)OC4=CC=CC=C43 |
Computed by PubChem (NCBI)