CAS 743453-07-8 appears in our catalog under these names: N-Phenyldibenzo[b,d]furan-4-amine, 98%, 98%, N-phenyldibenzo[b,d]furan-4-amine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g.
N-phenyldibenzofuran-4-amine (CAS 743453-07-8) is a chemical compound with the molecular formula C18H13NO and a molecular weight of 259.3 g/mol. IUPAC name: N-phenyldibenzofuran-4-amine. InChIKey: OZQLWSABIFMTOM-UHFFFAOYSA-N.
| Molecular formula | C18H13NO |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | N-phenyldibenzofuran-4-amine |
| InChIKey | OZQLWSABIFMTOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC3=C2OC4=CC=CC=C34 |
Computed by PubChem (NCBI)