CAS 222620-05-5 appears in our catalog under these names: 4-(9H-Carbazol-9-yl)phenol, 98%, 4-(9H-Carbazol-9-yl)phenol 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g, 25g, 100g.
4-carbazol-9-ylphenol (CAS 222620-05-5) is a chemical compound with the molecular formula C18H13NO and a molecular weight of 259.3 g/mol. IUPAC name: 4-carbazol-9-ylphenol. InChIKey: JOYGDTAPXVGLLE-UHFFFAOYSA-N.
| Molecular formula | C18H13NO |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 4-carbazol-9-ylphenol |
| InChIKey | JOYGDTAPXVGLLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)