CAS 578027-21-1 appears in our catalog under these names: 4–(Dibenzo(b,d)furan–4–yl)aniline, 4-(Dibenzo[b,d]furan-4-yl)aniline 98%, 4-(Dibenzo[b,d]furan-4-yl)aniline, 99%, 99%, 4-(Dibenzo[b,d]furan-4-yl)aniline, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g, 100g, 250mg.
4-dibenzofuran-4-ylaniline (CAS 578027-21-1) is a chemical compound with the molecular formula C18H13NO and a molecular weight of 259.3 g/mol. IUPAC name: 4-dibenzofuran-4-ylaniline. InChIKey: JPNNLBQKGZVDPF-UHFFFAOYSA-N.
| Molecular formula | C18H13NO |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 4-dibenzofuran-4-ylaniline |
| InChIKey | JPNNLBQKGZVDPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)