CAS 1036396-38-9 is the registry number for 3-(4-Chloro-3,5-difluorophenyl)propanal, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chloro-3,5-difluorophenyl)propanal (CAS 1036396-38-9) is a chemical compound with the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. IUPAC name: 3-(4-chloro-3,5-difluorophenyl)propanal. InChIKey: UXTVSKFUNRMBSS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O |
|---|---|
| Molecular weight | 204.60 g/mol |
| IUPAC name | 3-(4-chloro-3,5-difluorophenyl)propanal |
| InChIKey | UXTVSKFUNRMBSS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)F)CCC=O |
Computed by PubChem (NCBI)