Products 55805-18-0
CAS 55805-18-0 is the registry number for 4-(1,1-Difluoroethyl)benzoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,1-difluoroethyl)benzoyl chloride (CAS 55805-18-0) is a chemical compound with the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. IUPAC name: 4-(1,1-difluoroethyl)benzoyl chloride. InChIKey: HYDNGAGYFLIVOM-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O |
|---|---|
| Molecular weight | 204.60 g/mol |
| IUPAC name | 4-(1,1-difluoroethyl)benzoyl chloride |
| InChIKey | HYDNGAGYFLIVOM-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(=O)Cl)(F)F |
Computed by PubChem (NCBI)