CAS 959406-43-0 is the registry number for 3-(5-Chloro-2,4-difluorophenyl)propanal, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-chloro-2,4-difluorophenyl)propanal (CAS 959406-43-0) is a chemical compound with the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. IUPAC name: 3-(5-chloro-2,4-difluorophenyl)propanal. InChIKey: OQRIYHHWFNLYJF-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O |
|---|---|
| Molecular weight | 204.60 g/mol |
| IUPAC name | 3-(5-chloro-2,4-difluorophenyl)propanal |
| InChIKey | OQRIYHHWFNLYJF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)F)CCC=O |
Computed by PubChem (NCBI)