Products 1221343-06-1
CAS 1221343-06-1 is the registry number for 1-Chloro-3-(3,5-difluorophenyl)propan-2-one, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1-chloro-3-(3,5-difluorophenyl)propan-2-one (CAS 1221343-06-1) is a chemical compound with the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. IUPAC name: 1-chloro-3-(3,5-difluorophenyl)propan-2-one. InChIKey: UPHFEUIVWWQICX-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O |
|---|---|
| Molecular weight | 204.60 g/mol |
| IUPAC name | 1-chloro-3-(3,5-difluorophenyl)propan-2-one |
| InChIKey | UPHFEUIVWWQICX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)CC(=O)CCl |
Computed by PubChem (NCBI)